About 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile
2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile (PubChem CID 44576152) has the molecular formula C11H5N3O2
and a molecular weight of 211.18 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile.
Molecular Properties
| Compound Name | 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile |
| PubChem CID | 44576152 |
| Molecular Formula | C11H5N3O2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H5N3O2/c12-4-8(5-13)9(6-14)7-1-2-10(15)11(16)3-7/h1-3,15-16H |
| InChIKey | ORMGLUKCDQMGKV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile?
The IUPAC name of 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile (CID 44576152) is 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile.
What is the SMILES notation for 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile?
The canonical SMILES for 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile is N#CC(C#N)=C(C#N)c1ccc(O)c(O)c1.
What is the InChIKey of 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile?
The InChIKey is ORMGLUKCDQMGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5N3O2/c12-4-8(5-13)9(6-14)7-1-2-10(15)11(16)3-7/h1-3,15-16H.
What are the key properties of 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile?
2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile has a molecular weight of 211.18 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydroxyphenyl)ethene-1,1,2-tricarbonitrile is sourced from PubChem (CID 44576152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).