C20H34O3 — CID 44576199
(1R,2S,4S,7S,9R,10S,12S,13S)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,9,13-triol (PubChem CID 44576199) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,2S,4S,7S,9R,10S,12S,13S)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,9,13-triol.
| Compound Name | (1R,2S,4S,7S,9R,10S,12S,13S)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,9,13-triol |
|---|---|
| PubChem CID | 44576199 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1R,2S,4S,7S,9R,10S,12S,13S)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-4,9,13-triol |
| SMILES | CC1(C)C[C@H](O)C[C@@]2(C)[C@H]1C[C@@H](O)[C@H]1C[C@H]3C[C@]12CC[C@]3(C)O |
| InChI | InChI=1S/C20H34O3/c1-17(2)10-13(21)11-18(3)16(17)8-15(22)14-7-12-9-20(14,18)6-5-19(12,4)23/h12-16,21-23H,5-11H2,1-4H3/t12-,13-,14+,15+,16-,18-,19-,20+/m0/s1 |
| InChIKey | XQVVNUQPNCRRAK-WAYOHNBESA-N |
| XLogP | 3.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |