C17H20O5 — CID 44576226
[(1R,3'aS,4S,5S,7'aR)-6',7'a-dimethyl-3-oxospiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a-dihydro-1H-indene]-4'-yl]methyl acetate (PubChem CID 44576226) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(1R,3'aS,4S,5S,7'aR)-6',7'a-dimethyl-3-oxospiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a-dihydro-1H-indene]-4'-yl]methyl acetate.
| Compound Name | [(1R,3'aS,4S,5S,7'aR)-6',7'a-dimethyl-3-oxospiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a-dihydro-1H-indene]-4'-yl]methyl acetate |
|---|---|
| PubChem CID | 44576226 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(1R,3'aS,4S,5S,7'aR)-6',7'a-dimethyl-3-oxospiro[2,6-dioxabicyclo[3.1.0]hexane-4,2'-3,3a-dihydro-1H-indene]-4'-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC(C)=C[C@@]2(C)C[C@]3(C[C@H]12)C(=O)O[C@H]1O[C@H]13 |
| InChI | InChI=1S/C17H20O5/c1-9-4-11(7-20-10(2)18)12-6-17(8-16(12,3)5-9)13-14(21-13)22-15(17)19/h4-5,12-14H,6-8H2,1-3H3/t12-,13-,14-,16+,17+/m1/s1 |
| InChIKey | CASYRJOEEQJNGF-VJDWVQAOSA-N |
| XLogP | 2.12 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|