C21H28O7S — CID 44576376
(1S,4S,5R,8R,9R,10R,12R,13R)-9-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-ol (PubChem CID 44576376) has the molecular formula C21H28O7S and a molecular weight of 424.52 g/mol. Its IUPAC name is (1S,4S,5R,8R,9R,10R,12R,13R)-9-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-ol.
| Compound Name | (1S,4S,5R,8R,9R,10R,12R,13R)-9-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-ol |
|---|---|
| PubChem CID | 44576376 |
| Molecular Formula | C21H28O7S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (1S,4S,5R,8R,9R,10R,12R,13R)-9-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@]34OO[C@@](C)(CC[C@@H]13)O[C@H]4O[C@@H](O)[C@]2(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28O7S/c1-13-9-10-16-20(3,29(23,24)14-7-5-4-6-8-14)17(22)25-18-21(16)15(13)11-12-19(2,26-18)27-28-21/h4-8,13,15-18,22H,9-12H2,1-3H3/t13-,15+,16+,17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | SHHUIHYJSPYMEU-WJAWIKDZSA-N |
| XLogP | 2.78 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|