C22H40O4Si — CID 44576387
(3S,4S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-[(2E)-6-methylhepta-2,5-dien-2-yl]-1-oxaspiro[2.5]octan-5-ol (PubChem CID 44576387) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (3S,4S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-[(2E)-6-methylhepta-2,5-dien-2-yl]-1-oxaspiro[2.5]octan-5-ol.
| Compound Name | (3S,4S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-[(2E)-6-methylhepta-2,5-dien-2-yl]-1-oxaspiro[2.5]octan-5-ol |
|---|---|
| PubChem CID | 44576387 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (3S,4S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-[(2E)-6-methylhepta-2,5-dien-2-yl]-1-oxaspiro[2.5]octan-5-ol |
| SMILES | CO[C@@H]1[C@]2(CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(O)/C(C)=C/CC=C(C)C)CO2 |
| InChI | InChI=1S/C22H40O4Si/c1-16(2)11-10-12-17(3)22(23)18(26-27(8,9)20(4,5)6)13-14-21(15-25-21)19(22)24-7/h11-12,18-19,23H,10,13-15H2,1-9H3/b17-12+/t18-,19+,21-,22-/m0/s1 |
| InChIKey | NZRQEJKRQQIFPR-WAFVLAOPSA-N |
| XLogP | 4.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|