C29H44N2O2 — CID 44576455
(2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(4-phenylpiperazin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 44576455) has the molecular formula C29H44N2O2 and a molecular weight of 452.68 g/mol. Its IUPAC name is (2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(4-phenylpiperazin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(4-phenylpiperazin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 44576455 |
| Molecular Formula | C29H44N2O2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | (2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(4-phenylpiperazin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](N3CCN(c4ccccc4)CC3)[C@@H](O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C29H44N2O2/c1-28-13-12-24-22(23(28)10-11-27(28)33)9-8-20-18-26(32)25(19-29(20,24)2)31-16-14-30(15-17-31)21-6-4-3-5-7-21/h3-7,20,22-27,32-33H,8-19H2,1-2H3/t20-,22-,23-,24-,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | LDFIPGKYVVIFCC-VZCLVPMLSA-N |
| XLogP | 4.55 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |