C6H9FO3 — CID 44576472
(2S,3R,5S)-5-[(E)-2-fluoroethenyl]oxolane-2,3-diol (PubChem CID 44576472) has the molecular formula C6H9FO3 and a molecular weight of 148.13 g/mol. Its IUPAC name is (2S,3R,5S)-5-[(E)-2-fluoroethenyl]oxolane-2,3-diol.
| Compound Name | (2S,3R,5S)-5-[(E)-2-fluoroethenyl]oxolane-2,3-diol |
|---|---|
| PubChem CID | 44576472 |
| Molecular Formula | C6H9FO3 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | (2S,3R,5S)-5-[(E)-2-fluoroethenyl]oxolane-2,3-diol |
| SMILES | O[C@@H]1C[C@@H](/C=C/F)O[C@@H]1O |
| InChI | InChI=1S/C6H9FO3/c7-2-1-4-3-5(8)6(9)10-4/h1-2,4-6,8-9H,3H2/b2-1+/t4-,5-,6+/m1/s1 |
| InChIKey | RAMMHDHURQRESN-NDMCQMBCSA-N |
| XLogP | -0.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |