About 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide
1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide (PubChem CID 44576660) has the molecular formula C28H35N5O3
and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide |
| PubChem CID | 44576660 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide |
| SMILES | CCNC1(C(N)=O)CCN(c2cnc(-c3ccc(OCC)cc3)c(-c3ccc(OCC)cc3)n2)CC1 |
| InChI | InChI=1S/C28H35N5O3/c1-4-31-28(27(29)34)15-17-33(18-16-28)24-19-30-25(20-7-11-22(12-8-20)35-5-2)26(32-24)21-9-13-23(14-10-21)36-6-3/h7-14,19,31H,4-6,15-18H2,1-3H3,(H2,29,34) |
| InChIKey | MXYAUZSZXRTBLD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide?
The IUPAC name of 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide (CID 44576660) is 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide.
What is the SMILES notation for 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide?
The canonical SMILES for 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide is CCNC1(C(N)=O)CCN(c2cnc(-c3ccc(OCC)cc3)c(-c3ccc(OCC)cc3)n2)CC1.
What is the InChIKey of 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide?
The InChIKey is MXYAUZSZXRTBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H35N5O3/c1-4-31-28(27(29)34)15-17-33(18-16-28)24-19-30-25(20-7-11-22(12-8-20)35-5-2)26(32-24)21-9-13-23(14-10-21)36-6-3/h7-14,19,31H,4-6,15-18H2,1-3H3,(H2,29,34).
What are the key properties of 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide?
1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide has a molecular weight of 489.62 g/mol, XLogP of 4.04, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5,6-bis(4-ethoxyphenyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide is sourced from PubChem (CID 44576660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).