3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

C8H4N2O2S — CID 44576688

IUPAC3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
SMILESN#Cc1csc2cc(C(=O)O)[nH]c12
InChIInChI=1S/C8H4N2O2S/c9-2-4-3-13-6-1-5(8(11)12)10-7(4)6/h1,3,10H,(H,11,12)
InChIKeyZNRHGXYWWLTGFU-UHFFFAOYSA-N
MW192.20 g/mol
LogP1.80
Rot. Bonds1

About 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 44576688) has the molecular formula C8H4N2O2S and a molecular weight of 192.20 g/mol. Its IUPAC name is 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.

Molecular Properties

Compound Name3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
PubChem CID44576688
Molecular FormulaC8H4N2O2S
Molecular Weight192.20 g/mol
Exact Mass192.00
IUPAC Name3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
SMILESN#Cc1csc2cc(C(=O)O)[nH]c12
InChIInChI=1S/C8H4N2O2S/c9-2-4-3-13-6-1-5(8(11)12)10-7(4)6/h1,3,10H,(H,11,12)
InChIKeyZNRHGXYWWLTGFU-UHFFFAOYSA-N
XLogP1.80
TPSA76.88 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.20
LogP ≤ 51.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CID 44576688) is 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is N#Cc1csc2cc(C(=O)O)[nH]c12.
What is the InChIKey of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is ZNRHGXYWWLTGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2S/c9-2-4-3-13-6-1-5(8(11)12)10-7(4)6/h1,3,10H,(H,11,12).
What are the key properties of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 192.20 g/mol, XLogP of 1.80, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 44576688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).