About 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 44576688) has the molecular formula C8H4N2O2S
and a molecular weight of 192.20 g/mol. Its IUPAC name is 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 44576688 |
| Molecular Formula | C8H4N2O2S |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | N#Cc1csc2cc(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C8H4N2O2S/c9-2-4-3-13-6-1-5(8(11)12)10-7(4)6/h1,3,10H,(H,11,12) |
| InChIKey | ZNRHGXYWWLTGFU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CID 44576688) is 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is N#Cc1csc2cc(C(=O)O)[nH]c12.
What is the InChIKey of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is ZNRHGXYWWLTGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2S/c9-2-4-3-13-6-1-5(8(11)12)10-7(4)6/h1,3,10H,(H,11,12).
What are the key properties of 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 192.20 g/mol, XLogP of 1.80, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 44576688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).