C10H20O4S — CID 44576719
(2S,3S,4S,5R)-2-(butylsulfanylmethyl)-5-methoxyoxolane-3,4-diol (PubChem CID 44576719) has the molecular formula C10H20O4S and a molecular weight of 236.33 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-(butylsulfanylmethyl)-5-methoxyoxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-(butylsulfanylmethyl)-5-methoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 44576719 |
| Molecular Formula | C10H20O4S |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (2S,3S,4S,5R)-2-(butylsulfanylmethyl)-5-methoxyoxolane-3,4-diol |
| SMILES | CCCCSC[C@H]1O[C@@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20O4S/c1-3-4-5-15-6-7-8(11)9(12)10(13-2)14-7/h7-12H,3-6H2,1-2H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | DUIJDEXDYUFRFE-DOLQZWNJSA-N |
| XLogP | 0.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|