C12H24O4S — CID 44576720
(2S,3S,4S,5R)-2-(hexylsulfanylmethyl)-5-methoxyoxolane-3,4-diol (PubChem CID 44576720) has the molecular formula C12H24O4S and a molecular weight of 264.39 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-(hexylsulfanylmethyl)-5-methoxyoxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-(hexylsulfanylmethyl)-5-methoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 44576720 |
| Molecular Formula | C12H24O4S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (2S,3S,4S,5R)-2-(hexylsulfanylmethyl)-5-methoxyoxolane-3,4-diol |
| SMILES | CCCCCCSC[C@H]1O[C@@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H24O4S/c1-3-4-5-6-7-17-8-9-10(13)11(14)12(15-2)16-9/h9-14H,3-8H2,1-2H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | QAAYKJVBWZYDDJ-WISYIIOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|