3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid

C13H8ClNO3 — CID 44576721

IUPAC3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2occ(-c3ccc(Cl)cc3)c2[nH]1
InChIInChI=1S/C13H8ClNO3/c14-8-3-1-7(2-4-8)9-6-18-11-5-10(13(16)17)15-12(9)11/h1-6,15H,(H,16,17)
InChIKeyZVGJXKACPSDECZ-UHFFFAOYSA-N
MW261.66 g/mol
LogP3.78
Rot. Bonds2

About 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid

3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 44576721) has the molecular formula C13H8ClNO3 and a molecular weight of 261.66 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid
PubChem CID44576721
Molecular FormulaC13H8ClNO3
Molecular Weight261.66 g/mol
Exact Mass261.02
IUPAC Name3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2occ(-c3ccc(Cl)cc3)c2[nH]1
InChIInChI=1S/C13H8ClNO3/c14-8-3-1-7(2-4-8)9-6-18-11-5-10(13(16)17)15-12(9)11/h1-6,15H,(H,16,17)
InChIKeyZVGJXKACPSDECZ-UHFFFAOYSA-N
XLogP3.78
TPSA66.23 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.66
LogP ≤ 53.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CID 44576721) is 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid is O=C(O)c1cc2occ(-c3ccc(Cl)cc3)c2[nH]1.
What is the InChIKey of 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is ZVGJXKACPSDECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO3/c14-8-3-1-7(2-4-8)9-6-18-11-5-10(13(16)17)15-12(9)11/h1-6,15H,(H,16,17).
What are the key properties of 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 261.66 g/mol, XLogP of 3.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 44576721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).