C23H32O4 — CID 44576741
5-hydroxy-2,8,8-trimethyl-6-(2-methylbutanoyl)-2-(4-methylpent-3-enyl)chromen-7-one (PubChem CID 44576741) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 5-hydroxy-2,8,8-trimethyl-6-(2-methylbutanoyl)-2-(4-methylpent-3-enyl)chromen-7-one.
| Compound Name | 5-hydroxy-2,8,8-trimethyl-6-(2-methylbutanoyl)-2-(4-methylpent-3-enyl)chromen-7-one |
|---|---|
| PubChem CID | 44576741 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 5-hydroxy-2,8,8-trimethyl-6-(2-methylbutanoyl)-2-(4-methylpent-3-enyl)chromen-7-one |
| SMILES | CCC(C)C(=O)C1=C(O)C2=C(OC(C)(CCC=C(C)C)C=C2)C(C)(C)C1=O |
| InChI | InChI=1S/C23H32O4/c1-8-15(4)18(24)17-19(25)16-11-13-23(7,12-9-10-14(2)3)27-21(16)22(5,6)20(17)26/h10-11,13,15,25H,8-9,12H2,1-7H3 |
| InChIKey | ZNBKWHSUBCVVCC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|