About methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate
methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate (PubChem CID 44576836) has the molecular formula C22H15NO2S
and a molecular weight of 357.43 g/mol. Its IUPAC name is methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate |
| PubChem CID | 44576836 |
| Molecular Formula | C22H15NO2S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccc3c4ccccc4sc3c2c1-c1ccccc1 |
| InChI | InChI=1S/C22H15NO2S/c1-25-22(24)20-18(13-7-3-2-4-8-13)19-16(23-20)12-11-15-14-9-5-6-10-17(14)26-21(15)19/h2-12,23H,1H3 |
| InChIKey | VADNDPHLWBDBSB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate?
The IUPAC name of methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate (CID 44576836) is methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate.
What is the SMILES notation for methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate?
The canonical SMILES for methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate is COC(=O)c1[nH]c2ccc3c4ccccc4sc3c2c1-c1ccccc1.
What is the InChIKey of methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate?
The InChIKey is VADNDPHLWBDBSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO2S/c1-25-22(24)20-18(13-7-3-2-4-8-13)19-16(23-20)12-11-15-14-9-5-6-10-17(14)26-21(15)19/h2-12,23H,1H3.
What are the key properties of methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate?
methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate has a molecular weight of 357.43 g/mol, XLogP of 5.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-phenyl-3H-[1]benzothiolo[2,3-e]indole-2-carboxylate is sourced from PubChem (CID 44576836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).