C26H19KO4S — CID 44576923
potassium 5-(6,6-dimethylhepta-2,4-diynoyl)-4-[4-[2-(methoxymethyl)phenyl]buta-1,3-diynyl]thiophene-2-carboxylate (PubChem CID 44576923) has the molecular formula C26H19KO4S and a molecular weight of 466.60 g/mol. Its IUPAC name is potassium 5-(6,6-dimethylhepta-2,4-diynoyl)-4-[4-[2-(methoxymethyl)phenyl]buta-1,3-diynyl]thiophene-2-carboxylate.
| Compound Name | potassium 5-(6,6-dimethylhepta-2,4-diynoyl)-4-[4-[2-(methoxymethyl)phenyl]buta-1,3-diynyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 44576923 |
| Molecular Formula | C26H19KO4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | potassium 5-(6,6-dimethylhepta-2,4-diynoyl)-4-[4-[2-(methoxymethyl)phenyl]buta-1,3-diynyl]thiophene-2-carboxylate |
| SMILES | COCc1ccccc1C#CC#Cc1cc(C(=O)[O-])sc1C(=O)C#CC#CC(C)(C)C.[K+] |
| InChI | InChI=1S/C26H20O4S.K/c1-26(2,3)16-10-9-15-22(27)24-20(17-23(31-24)25(28)29)13-7-5-11-19-12-6-8-14-21(19)18-30-4;/h6,8,12,14,17H,18H2,1-4H3,(H,28,29);/q;+1/p-1 |
| InChIKey | VELMIMNBRWPNKQ-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|