About 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine
2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine (PubChem CID 44576985) has the molecular formula C7H16N8
and a molecular weight of 212.26 g/mol. Its IUPAC name is 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine.
Molecular Properties
| Compound Name | 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine |
| PubChem CID | 44576985 |
| Molecular Formula | C7H16N8 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine |
| SMILES | CC(/C=C(\C)NN=C(N)N)=N/N=C(N)N |
| InChI | InChI=1S/C7H16N8/c1-4(12-14-6(8)9)3-5(2)13-15-7(10)11/h3,12H,1-2H3,(H4,8,9,14)(H4,10,11,15)/b4-3+,13-5- |
| InChIKey | DFGLYSSSRMBBHL-XKZGMXHESA-N |
| XLogP | -1.68 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine?
The IUPAC name of 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine (CID 44576985) is 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine.
What is the SMILES notation for 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine?
The canonical SMILES for 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine is CC(/C=C(\C)NN=C(N)N)=N/N=C(N)N.
What is the InChIKey of 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine?
The InChIKey is DFGLYSSSRMBBHL-XKZGMXHESA-N. The full InChI is InChI=1S/C7H16N8/c1-4(12-14-6(8)9)3-5(2)13-15-7(10)11/h3,12H,1-2H3,(H4,8,9,14)(H4,10,11,15)/b4-3+,13-5-.
What are the key properties of 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine?
2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine has a molecular weight of 212.26 g/mol, XLogP of -1.68, 4 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E,4Z)-4-(diaminomethylidenehydrazinylidene)pent-2-en-2-yl]amino]guanidine is sourced from PubChem (CID 44576985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).