C19H27N3O — CID 44577049
(1S,13R)-5-amino-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4-carboxamide (PubChem CID 44577049) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (1S,13R)-5-amino-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4-carboxamide.
| Compound Name | (1S,13R)-5-amino-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4-carboxamide |
|---|---|
| PubChem CID | 44577049 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (1S,13R)-5-amino-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-4-carboxamide |
| SMILES | C[C@H]1C2Cc3cc(N)c(C(N)=O)cc3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C19H27N3O/c1-11-17-8-13-7-16(20)14(18(21)23)9-15(13)19(11,2)5-6-22(17)10-12-3-4-12/h7,9,11-12,17H,3-6,8,10,20H2,1-2H3,(H2,21,23)/t11-,17?,19-/m0/s1 |
| InChIKey | YPOOBCHYMBAZRM-LFVLMCKFSA-N |
| XLogP | 2.30 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|