About 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine
4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine (PubChem CID 44577141) has the molecular formula C15H19ClN4
and a molecular weight of 290.80 g/mol. Its IUPAC name is 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine.
Molecular Properties
| Compound Name | 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine |
| PubChem CID | 44577141 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine |
| SMILES | NCCCC/N=c1/c2ccc(Cl)cc2nc2n1CCC2 |
| InChI | InChI=1S/C15H19ClN4/c16-11-5-6-12-13(10-11)19-14-4-3-9-20(14)15(12)18-8-2-1-7-17/h5-6,10H,1-4,7-9,17H2/b18-15- |
| InChIKey | UBJUTJSKBLDPOR-SDXDJHTJSA-N |
| XLogP | 2.28 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine?
The IUPAC name of 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine (CID 44577141) is 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine.
What is the SMILES notation for 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine?
The canonical SMILES for 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine is NCCCC/N=c1/c2ccc(Cl)cc2nc2n1CCC2.
What is the InChIKey of 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine?
The InChIKey is UBJUTJSKBLDPOR-SDXDJHTJSA-N. The full InChI is InChI=1S/C15H19ClN4/c16-11-5-6-12-13(10-11)19-14-4-3-9-20(14)15(12)18-8-2-1-7-17/h5-6,10H,1-4,7-9,17H2/b18-15-.
What are the key properties of 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine?
4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine has a molecular weight of 290.80 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]butan-1-amine is sourced from PubChem (CID 44577141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).