About 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol
4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol (PubChem CID 44577292) has the molecular formula C22H20O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol |
| PubChem CID | 44577292 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol |
| SMILES | Oc1cc(-c2ccccc2)c(OCC2CC2)c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C22H20O3/c23-19-13-18(16-7-3-1-4-8-16)22(25-14-15-11-12-15)21(24)20(19)17-9-5-2-6-10-17/h1-10,13,15,23-24H,11-12,14H2 |
| InChIKey | YWXOPDHQAOKPGZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol?
The IUPAC name of 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol (CID 44577292) is 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol.
What is the SMILES notation for 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol?
The canonical SMILES for 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol is Oc1cc(-c2ccccc2)c(OCC2CC2)c(O)c1-c1ccccc1.
What is the InChIKey of 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol?
The InChIKey is YWXOPDHQAOKPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O3/c23-19-13-18(16-7-3-1-4-8-16)22(25-14-15-11-12-15)21(24)20(19)17-9-5-2-6-10-17/h1-10,13,15,23-24H,11-12,14H2.
What are the key properties of 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol?
4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol has a molecular weight of 332.40 g/mol, XLogP of 5.22, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopropylmethoxy)-2,5-diphenylbenzene-1,3-diol is sourced from PubChem (CID 44577292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).