About N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine
N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine (PubChem CID 44577415) has the molecular formula C13H23N3O3
and a molecular weight of 269.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine |
| PubChem CID | 44577415 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine |
| SMILES | COCCNc1cc(OC(C)C)nc(OC(C)C)n1 |
| InChI | InChI=1S/C13H23N3O3/c1-9(2)18-12-8-11(14-6-7-17-5)15-13(16-12)19-10(3)4/h8-10H,6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | QWJSKUBBHKFOHJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine?
The IUPAC name of N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine (CID 44577415) is N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine.
What is the SMILES notation for N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine?
The canonical SMILES for N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine is COCCNc1cc(OC(C)C)nc(OC(C)C)n1.
What is the InChIKey of N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine?
The InChIKey is QWJSKUBBHKFOHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O3/c1-9(2)18-12-8-11(14-6-7-17-5)15-13(16-12)19-10(3)4/h8-10H,6-7H2,1-5H3,(H,14,15,16).
What are the key properties of N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine?
N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine has a molecular weight of 269.34 g/mol, XLogP of 2.11, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-2,6-di(propan-2-yloxy)pyrimidin-4-amine is sourced from PubChem (CID 44577415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).