About 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea
1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea (PubChem CID 44577419) has the molecular formula C19H21ClN2O2S
and a molecular weight of 376.91 g/mol. Its IUPAC name is 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea.
Molecular Properties
| Compound Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea |
| PubChem CID | 44577419 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)NC2CC(C)(C)Oc3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C19H21ClN2O2S/c1-19(2)11-16(15-9-12(20)7-8-17(15)24-19)22-18(25)21-13-5-4-6-14(10-13)23-3/h4-10,16H,11H2,1-3H3,(H2,21,22,25) |
| InChIKey | OJCOLKJICCFGPV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea?
The IUPAC name of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea (CID 44577419) is 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea.
What is the SMILES notation for 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea?
The canonical SMILES for 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea is COc1cccc(NC(=S)NC2CC(C)(C)Oc3ccc(Cl)cc32)c1.
What is the InChIKey of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea?
The InChIKey is OJCOLKJICCFGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O2S/c1-19(2)11-16(15-9-12(20)7-8-17(15)24-19)22-18(25)21-13-5-4-6-14(10-13)23-3/h4-10,16H,11H2,1-3H3,(H2,21,22,25).
What are the key properties of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea?
1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea has a molecular weight of 376.91 g/mol, XLogP of 4.94, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-methoxyphenyl)thiourea is sourced from PubChem (CID 44577419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).