C13H25N5O3 — CID 44577491
2-(2-aminoethoxy)-6-[2-(dimethylamino)ethoxy]-N-(2-methoxyethyl)pyrimidin-4-amine (PubChem CID 44577491) has the molecular formula C13H25N5O3 and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-6-[2-(dimethylamino)ethoxy]-N-(2-methoxyethyl)pyrimidin-4-amine.
| Compound Name | 2-(2-aminoethoxy)-6-[2-(dimethylamino)ethoxy]-N-(2-methoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 44577491 |
| Molecular Formula | C13H25N5O3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-(2-aminoethoxy)-6-[2-(dimethylamino)ethoxy]-N-(2-methoxyethyl)pyrimidin-4-amine |
| SMILES | COCCNc1cc(OCCN(C)C)nc(OCCN)n1 |
| InChI | InChI=1S/C13H25N5O3/c1-18(2)6-9-20-12-10-11(15-5-8-19-3)16-13(17-12)21-7-4-14/h10H,4-9,14H2,1-3H3,(H,15,16,17) |
| InChIKey | MEZMRDXFRRZJLG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|