C27H32N4 — CID 44577524
(1S,17R)-N-benzyl-14-(cyclopropylmethyl)-1,17-dimethyl-4,6,14-triazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),4,6,9-pentaen-7-amine (PubChem CID 44577524) has the molecular formula C27H32N4 and a molecular weight of 412.58 g/mol. Its IUPAC name is (1S,17R)-N-benzyl-14-(cyclopropylmethyl)-1,17-dimethyl-4,6,14-triazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),4,6,9-pentaen-7-amine.
| Compound Name | (1S,17R)-N-benzyl-14-(cyclopropylmethyl)-1,17-dimethyl-4,6,14-triazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),4,6,9-pentaen-7-amine |
|---|---|
| PubChem CID | 44577524 |
| Molecular Formula | C27H32N4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (1S,17R)-N-benzyl-14-(cyclopropylmethyl)-1,17-dimethyl-4,6,14-triazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),4,6,9-pentaen-7-amine |
| SMILES | C[C@H]1C2Cc3ccc4c(NCc5ccccc5)ncnc4c3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C27H32N4/c1-18-23-14-21-10-11-22-25(24(21)27(18,2)12-13-31(23)16-20-8-9-20)29-17-30-26(22)28-15-19-6-4-3-5-7-19/h3-7,10-11,17-18,20,23H,8-9,12-16H2,1-2H3,(H,28,29,30)/t18-,23?,27-/m0/s1 |
| InChIKey | BKLNRKUOWAHYHB-NZIOIMPVSA-N |
| XLogP | 5.18 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |