C34H38N4 — CID 44577525
(1S,17R)-14-(cyclopropylmethyl)-1,17-dimethyl-N-[2-(4-phenylphenyl)ethyl]-6,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10-pentaen-5-amine (PubChem CID 44577525) has the molecular formula C34H38N4 and a molecular weight of 502.71 g/mol. Its IUPAC name is (1S,17R)-14-(cyclopropylmethyl)-1,17-dimethyl-N-[2-(4-phenylphenyl)ethyl]-6,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10-pentaen-5-amine.
| Compound Name | (1S,17R)-14-(cyclopropylmethyl)-1,17-dimethyl-N-[2-(4-phenylphenyl)ethyl]-6,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10-pentaen-5-amine |
|---|---|
| PubChem CID | 44577525 |
| Molecular Formula | C34H38N4 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (1S,17R)-14-(cyclopropylmethyl)-1,17-dimethyl-N-[2-(4-phenylphenyl)ethyl]-6,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10-pentaen-5-amine |
| SMILES | C[C@H]1C2Cc3cc4ncnc(NCCc5ccc(-c6ccccc6)cc5)c4cc3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C34H38N4/c1-23-32-19-28-18-31-29(20-30(28)34(23,2)15-17-38(32)21-25-8-9-25)33(37-22-36-31)35-16-14-24-10-12-27(13-11-24)26-6-4-3-5-7-26/h3-7,10-13,18,20,22-23,25,32H,8-9,14-17,19,21H2,1-2H3,(H,35,36,37)/t23-,32?,34-/m0/s1 |
| InChIKey | VTSPZQZEFPWUGM-HUSBTFBPSA-N |
| XLogP | 6.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |