C20H19N5O2S — CID 44577641
6,6-dimethyl-2-(6-pyrimidin-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 44577641) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is 6,6-dimethyl-2-(6-pyrimidin-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 6,6-dimethyl-2-(6-pyrimidin-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 44577641 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 6,6-dimethyl-2-(6-pyrimidin-2-yl-2,3-dihydro-1,4-benzoxazin-4-yl)-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | CC1(C)Cc2nc(N3CCOc4ccc(-c5ncccn5)cc43)sc2C(=O)N1 |
| InChI | InChI=1S/C20H19N5O2S/c1-20(2)11-13-16(18(26)24-20)28-19(23-13)25-8-9-27-15-5-4-12(10-14(15)25)17-21-6-3-7-22-17/h3-7,10H,8-9,11H2,1-2H3,(H,24,26) |
| InChIKey | IXHVRQYFTXKBPO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |