C19H22N2O2 — CID 44577822
2-(furan-2-yl)-5-(7-phenylheptyl)-1,3,4-oxadiazole (PubChem CID 44577822) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-(7-phenylheptyl)-1,3,4-oxadiazole.
| Compound Name | 2-(furan-2-yl)-5-(7-phenylheptyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 44577822 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-(furan-2-yl)-5-(7-phenylheptyl)-1,3,4-oxadiazole |
| SMILES | c1ccc(CCCCCCCc2nnc(-c3ccco3)o2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1(2-5-10-16-11-6-4-7-12-16)3-8-14-18-20-21-19(23-18)17-13-9-15-22-17/h4,6-7,9,11-13,15H,1-3,5,8,10,14H2 |
| InChIKey | AQNZKADSRQDBJQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|