C19H20ClN9O — CID 44577872
5-[[[(2R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-2-yl]amino]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 44577872) has the molecular formula C19H20ClN9O and a molecular weight of 425.88 g/mol. Its IUPAC name is 5-[[[(2R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-2-yl]amino]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-[[[(2R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-2-yl]amino]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 44577872 |
| Molecular Formula | C19H20ClN9O |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-[[[(2R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-2-yl]amino]methyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(CN[C@H]2CCCN2Cc2ccnc(Cl)c2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C19H20ClN9O/c20-14-9-12(5-6-22-14)11-28-7-1-4-16(28)23-10-15-24-18(21)29-19(25-15)26-17(27-29)13-3-2-8-30-13/h2-3,5-6,8-9,16,23H,1,4,7,10-11H2,(H2,21,24,25,26,27)/t16-/m1/s1 |
| InChIKey | CQNPTEQAAAOVKX-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|