C20H19NO8 — CID 44578210
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(morpholin-4-ylmethyl)chromen-4-one (PubChem CID 44578210) has the molecular formula C20H19NO8 and a molecular weight of 401.37 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(morpholin-4-ylmethyl)chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(morpholin-4-ylmethyl)chromen-4-one |
|---|---|
| PubChem CID | 44578210 |
| Molecular Formula | C20H19NO8 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(morpholin-4-ylmethyl)chromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(CN3CCOCC3)c(O)cc(O)c12 |
| InChI | InChI=1S/C20H19NO8/c22-12-2-1-10(7-14(12)24)19-18(27)17(26)16-15(25)8-13(23)11(20(16)29-19)9-21-3-5-28-6-4-21/h1-2,7-8,22-25,27H,3-6,9H2 |
| InChIKey | AXRHXXMWCDPIIB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|