C30H39N3O6 — CID 44578285
(3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 44578285) has the molecular formula C30H39N3O6 and a molecular weight of 537.66 g/mol. Its IUPAC name is (3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 44578285 |
| Molecular Formula | C30H39N3O6 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | (3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@H](Cc2ccccc2)C(=O)N[C@@H](CO)C(=O)N[C@H](Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C30H39N3O6/c1-3-4-11-20(2)26-18-27(35)31-23(16-21-12-7-5-8-13-21)28(36)33-25(19-34)29(37)32-24(30(38)39-26)17-22-14-9-6-10-15-22/h5-10,12-15,20,23-26,34H,3-4,11,16-19H2,1-2H3,(H,31,35)(H,32,37)(H,33,36)/t20-,23+,24+,25-,26-/m0/s1 |
| InChIKey | HALKVOJKJUBYKR-XLWYRUSESA-N |
| XLogP | 2.06 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |