C36H43N3O6 — CID 44578286
(3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 44578286) has the molecular formula C36H43N3O6 and a molecular weight of 613.76 g/mol. Its IUPAC name is (3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 44578286 |
| Molecular Formula | C36H43N3O6 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | (3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](C(c2ccccc2)c2ccccc2)C(=O)N[C@@H](CO)C(=O)N[C@H](Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C36H43N3O6/c1-3-4-14-24(2)30-22-31(41)39-33(32(26-17-10-6-11-18-26)27-19-12-7-13-20-27)35(43)38-29(23-40)34(42)37-28(36(44)45-30)21-25-15-8-5-9-16-25/h5-13,15-20,24,28-30,32-33,40H,3-4,14,21-23H2,1-2H3,(H,37,42)(H,38,43)(H,39,41)/t24-,28+,29-,30-,33-/m0/s1 |
| InChIKey | VCNHWGSXAJOATR-LVVAXXGVSA-N |
| XLogP | 3.65 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |