C30H39N3O5 — CID 44578325
(3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 44578325) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is (3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 44578325 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | (3R,6S,9R,13S)-3,9-dibenzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@H](Cc2ccccc2)C(=O)N[C@@H](C)C(=O)N[C@H](Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C30H39N3O5/c1-4-5-12-20(2)26-19-27(34)32-24(17-22-13-8-6-9-14-22)29(36)31-21(3)28(35)33-25(30(37)38-26)18-23-15-10-7-11-16-23/h6-11,13-16,20-21,24-26H,4-5,12,17-19H2,1-3H3,(H,31,36)(H,32,34)(H,33,35)/t20-,21-,24+,25+,26-/m0/s1 |
| InChIKey | AMAHLTRORINZQV-MAGJXBCQSA-N |
| XLogP | 3.09 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |