C36H43N3O5 — CID 44578328
(3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 44578328) has the molecular formula C36H43N3O5 and a molecular weight of 597.76 g/mol. Its IUPAC name is (3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 44578328 |
| Molecular Formula | C36H43N3O5 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | (3R,6S,9S,13S)-9-benzhydryl-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](C(c2ccccc2)c2ccccc2)C(=O)N[C@@H](C)C(=O)N[C@H](Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C36H43N3O5/c1-4-5-15-24(2)30-23-31(40)39-33(32(27-18-11-7-12-19-27)28-20-13-8-14-21-28)35(42)37-25(3)34(41)38-29(36(43)44-30)22-26-16-9-6-10-17-26/h6-14,16-21,24-25,29-30,32-33H,4-5,15,22-23H2,1-3H3,(H,37,42)(H,38,41)(H,39,40)/t24-,25-,29+,30-,33-/m0/s1 |
| InChIKey | BQVLECMLFYHZDZ-DFIXXEOTSA-N |
| XLogP | 4.68 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |