C33H45N3O5 — CID 44578334
(3R,6R,9S,13S)-9-benzhydryl-13-[(2S)-hexan-2-yl]-6-methyl-3-(2-methylpropyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 44578334) has the molecular formula C33H45N3O5 and a molecular weight of 563.74 g/mol. Its IUPAC name is (3R,6R,9S,13S)-9-benzhydryl-13-[(2S)-hexan-2-yl]-6-methyl-3-(2-methylpropyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6R,9S,13S)-9-benzhydryl-13-[(2S)-hexan-2-yl]-6-methyl-3-(2-methylpropyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 44578334 |
| Molecular Formula | C33H45N3O5 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | (3R,6R,9S,13S)-9-benzhydryl-13-[(2S)-hexan-2-yl]-6-methyl-3-(2-methylpropyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](C(c2ccccc2)c2ccccc2)C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)O1 |
| InChI | InChI=1S/C33H45N3O5/c1-6-7-14-22(4)27-20-28(37)36-30(29(24-15-10-8-11-16-24)25-17-12-9-13-18-25)32(39)34-23(5)31(38)35-26(19-21(2)3)33(40)41-27/h8-13,15-18,21-23,26-27,29-30H,6-7,14,19-20H2,1-5H3,(H,34,39)(H,35,38)(H,36,37)/t22-,23+,26+,27-,30-/m0/s1 |
| InChIKey | INZUFUKKBNFQCO-OBVJZYNASA-N |
| XLogP | 4.48 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |