About 4-(2-aminoethyl)-3,5-difluorophenol
4-(2-aminoethyl)-3,5-difluorophenol (PubChem CID 44578415) has the molecular formula C8H9F2NO
and a molecular weight of 173.16 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3,5-difluorophenol.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-3,5-difluorophenol |
| PubChem CID | 44578415 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 4-(2-aminoethyl)-3,5-difluorophenol |
| SMILES | NCCc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C8H9F2NO/c9-7-3-5(12)4-8(10)6(7)1-2-11/h3-4,12H,1-2,11H2 |
| InChIKey | RWSBYJCYOKCTOS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminoethyl)-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-3,5-difluorophenol?
The IUPAC name of 4-(2-aminoethyl)-3,5-difluorophenol (CID 44578415) is 4-(2-aminoethyl)-3,5-difluorophenol.
What is the SMILES notation for 4-(2-aminoethyl)-3,5-difluorophenol?
The canonical SMILES for 4-(2-aminoethyl)-3,5-difluorophenol is NCCc1c(F)cc(O)cc1F.
What is the InChIKey of 4-(2-aminoethyl)-3,5-difluorophenol?
The InChIKey is RWSBYJCYOKCTOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO/c9-7-3-5(12)4-8(10)6(7)1-2-11/h3-4,12H,1-2,11H2.
What are the key properties of 4-(2-aminoethyl)-3,5-difluorophenol?
4-(2-aminoethyl)-3,5-difluorophenol has a molecular weight of 173.16 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-3,5-difluorophenol is sourced from PubChem (CID 44578415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).