About 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one
7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one (PubChem CID 44578443) has the molecular formula C23H27NO5
and a molecular weight of 397.47 g/mol. Its IUPAC name is 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one.
Molecular Properties
| Compound Name | 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one |
| PubChem CID | 44578443 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCCCCOc3cc(O)cc(N(C)C)c3)cc2oc1=O |
| InChI | InChI=1S/C23H27NO5/c1-15-16(2)23(26)29-22-14-19(7-8-21(15)22)27-9-5-6-10-28-20-12-17(24(3)4)11-18(25)13-20/h7-8,11-14,25H,5-6,9-10H2,1-4H3 |
| InChIKey | NUUDVYYCWRJWMB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one?
The IUPAC name of 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one (CID 44578443) is 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one.
What is the SMILES notation for 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one?
The canonical SMILES for 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one is Cc1c(C)c2ccc(OCCCCOc3cc(O)cc(N(C)C)c3)cc2oc1=O.
What is the InChIKey of 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one?
The InChIKey is NUUDVYYCWRJWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO5/c1-15-16(2)23(26)29-22-14-19(7-8-21(15)22)27-9-5-6-10-28-20-12-17(24(3)4)11-18(25)13-20/h7-8,11-14,25H,5-6,9-10H2,1-4H3.
What are the key properties of 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one?
7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one has a molecular weight of 397.47 g/mol, XLogP of 4.42, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[3-(dimethylamino)-5-hydroxyphenoxy]butoxy]-3,4-dimethylchromen-2-one is sourced from PubChem (CID 44578443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).