About [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide
[3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide (PubChem CID 44578479) has the molecular formula C23H28INO5
and a molecular weight of 525.38 g/mol. Its IUPAC name is [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide |
| PubChem CID | 44578479 |
| Molecular Formula | C23H28INO5 |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide |
| SMILES | Cc1c(C)c2ccc(OCCCOc3cc(O)cc([N+](C)(C)C)c3)cc2oc1=O.[I-] |
| InChI | InChI=1S/C23H27NO5.HI/c1-15-16(2)23(26)29-22-14-19(7-8-21(15)22)27-9-6-10-28-20-12-17(24(3,4)5)11-18(25)13-20;/h7-8,11-14H,6,9-10H2,1-5H3;1H |
| InChIKey | ANOBKSRPWWJDLQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide?
The IUPAC name of [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide (CID 44578479) is [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide.
What is the SMILES notation for [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide?
The canonical SMILES for [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide is Cc1c(C)c2ccc(OCCCOc3cc(O)cc([N+](C)(C)C)c3)cc2oc1=O.[I-].
What is the InChIKey of [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide?
The InChIKey is ANOBKSRPWWJDLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO5.HI/c1-15-16(2)23(26)29-22-14-19(7-8-21(15)22)27-9-6-10-28-20-12-17(24(3,4)5)11-18(25)13-20;/h7-8,11-14H,6,9-10H2,1-5H3;1H.
What are the key properties of [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide?
[3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide has a molecular weight of 525.38 g/mol, XLogP of 1.16, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropoxy]-5-hydroxyphenyl]-trimethylazanium iodide is sourced from PubChem (CID 44578479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).