C26H20Cl2N4+2 — CID 44578490
6-chloro-2-[(Z)-4-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)but-2-enyl]-9H-pyrido[3,4-b]indol-2-ium (PubChem CID 44578490) has the molecular formula C26H20Cl2N4+2 and a molecular weight of 459.38 g/mol. Its IUPAC name is 6-chloro-2-[(Z)-4-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)but-2-enyl]-9H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 6-chloro-2-[(Z)-4-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)but-2-enyl]-9H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 44578490 |
| Molecular Formula | C26H20Cl2N4+2 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 6-chloro-2-[(Z)-4-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)but-2-enyl]-9H-pyrido[3,4-b]indol-2-ium |
| SMILES | Clc1ccc2[nH]c3c[n+](C/C=C\C[n+]4ccc5c(c4)[nH]c4ccc(Cl)cc45)ccc3c2c1 |
| InChI | InChI=1S/C26H18Cl2N4/c27-17-3-5-23-21(13-17)19-7-11-31(15-25(19)29-23)9-1-2-10-32-12-8-20-22-14-18(28)4-6-24(22)30-26(20)16-32/h1-8,11-16H,9-10H2/p+2/b2-1- |
| InChIKey | AEDHAGMCCVCQTJ-UPHRSURJSA-P |
| XLogP | 6.09 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|