C30H30Br2Cl2N4 — CID 44578550
6-chloro-2-[8-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-9H-pyrido[3,4-b]indol-2-ium dibromide (PubChem CID 44578550) has the molecular formula C30H30Br2Cl2N4 and a molecular weight of 677.31 g/mol. Its IUPAC name is 6-chloro-2-[8-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-9H-pyrido[3,4-b]indol-2-ium dibromide.
| Compound Name | 6-chloro-2-[8-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-9H-pyrido[3,4-b]indol-2-ium dibromide |
|---|---|
| PubChem CID | 44578550 |
| Molecular Formula | C30H30Br2Cl2N4 |
| Molecular Weight | 677.31 g/mol |
| Exact Mass | 674.02 |
| IUPAC Name | 6-chloro-2-[8-(6-chloro-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-9H-pyrido[3,4-b]indol-2-ium dibromide |
| SMILES | Clc1ccc2[nH]c3c[n+](CCCCCCCC[n+]4ccc5c(c4)[nH]c4ccc(Cl)cc45)ccc3c2c1.[Br-].[Br-] |
| InChI | InChI=1S/C30H28Cl2N4.2BrH/c31-21-7-9-27-25(17-21)23-11-15-35(19-29(23)33-27)13-5-3-1-2-4-6-14-36-16-12-24-26-18-22(32)8-10-28(26)34-30(24)20-36;;/h7-12,15-20H,1-6,13-14H2;2*1H |
| InChIKey | GJILVDSQLDAILL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|