C22H19N5OS — CID 44578758
(E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-dimethylprop-2-enamide (PubChem CID 44578758) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is (E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 44578758 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-dimethylprop-2-enamide |
| SMILES | Cc1c(Nc2c(C#N)cnc3sc(/C=C/C(=O)N(C)C)cc23)ccc2[nH]ccc12 |
| InChI | InChI=1S/C22H19N5OS/c1-13-16-8-9-24-19(16)6-5-18(13)26-21-14(11-23)12-25-22-17(21)10-15(29-22)4-7-20(28)27(2)3/h4-10,12,24H,1-3H3,(H,25,26)/b7-4+ |
| InChIKey | JELDBBFVVGTYRF-QPJJXVBHSA-N |
| XLogP | 4.80 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|