C24H23N5OS — CID 44578813
(E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-diethylprop-2-enamide (PubChem CID 44578813) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is (E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-diethylprop-2-enamide.
| Compound Name | (E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 44578813 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (E)-3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/c1cc2c(Nc3ccc4[nH]ccc4c3C)c(C#N)cnc2s1 |
| InChI | InChI=1S/C24H23N5OS/c1-4-29(5-2)22(30)9-6-17-12-19-23(16(13-25)14-27-24(19)31-17)28-20-7-8-21-18(15(20)3)10-11-26-21/h6-12,14,26H,4-5H2,1-3H3,(H,27,28)/b9-6+ |
| InChIKey | GLKZLGGCNUQEAN-RMKNXTFCSA-N |
| XLogP | 5.58 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|