About (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine
(2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine (PubChem CID 44578972) has the molecular formula C16H16F2N2O2
and a molecular weight of 306.31 g/mol. Its IUPAC name is (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine.
Molecular Properties
| Compound Name | (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine |
| PubChem CID | 44578972 |
| Molecular Formula | C16H16F2N2O2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine |
| SMILES | Fc1cccc(F)c1O[C@@H](c1ccccn1)[C@@H]1CNCCO1 |
| InChI | InChI=1S/C16H16F2N2O2/c17-11-4-3-5-12(18)15(11)22-16(13-6-1-2-7-20-13)14-10-19-8-9-21-14/h1-7,14,16,19H,8-10H2/t14-,16-/m0/s1 |
| InChIKey | QIVITPMRYRPJPE-HOCLYGCPSA-N |
| XLogP | 2.47 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine?
The IUPAC name of (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine (CID 44578972) is (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine.
What is the SMILES notation for (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine?
The canonical SMILES for (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine is Fc1cccc(F)c1O[C@@H](c1ccccn1)[C@@H]1CNCCO1.
What is the InChIKey of (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine?
The InChIKey is QIVITPMRYRPJPE-HOCLYGCPSA-N. The full InChI is InChI=1S/C16H16F2N2O2/c17-11-4-3-5-12(18)15(11)22-16(13-6-1-2-7-20-13)14-10-19-8-9-21-14/h1-7,14,16,19H,8-10H2/t14-,16-/m0/s1.
What are the key properties of (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine?
(2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine has a molecular weight of 306.31 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(S)-(2,6-difluorophenoxy)-pyridin-2-ylmethyl]morpholine is sourced from PubChem (CID 44578972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).