C15H15ClF3N3 — CID 44578999
[4-chloro-3-(trifluoromethyl)phenyl]-(1,2,3,5,6,7-hexahydroindolizin-8-yl)diazene (PubChem CID 44578999) has the molecular formula C15H15ClF3N3 and a molecular weight of 329.75 g/mol. Its IUPAC name is [4-chloro-3-(trifluoromethyl)phenyl]-(1,2,3,5,6,7-hexahydroindolizin-8-yl)diazene.
| Compound Name | [4-chloro-3-(trifluoromethyl)phenyl]-(1,2,3,5,6,7-hexahydroindolizin-8-yl)diazene |
|---|---|
| PubChem CID | 44578999 |
| Molecular Formula | C15H15ClF3N3 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [4-chloro-3-(trifluoromethyl)phenyl]-(1,2,3,5,6,7-hexahydroindolizin-8-yl)diazene |
| SMILES | FC(F)(F)c1cc(/N=N/C2=C3CCCN3CCC2)ccc1Cl |
| InChI | InChI=1S/C15H15ClF3N3/c16-12-6-5-10(9-11(12)15(17,18)19)20-21-13-3-1-7-22-8-2-4-14(13)22/h5-6,9H,1-4,7-8H2/b21-20+ |
| InChIKey | UXGVEROISSGXOR-QZQOTICOSA-N |
| XLogP | 5.54 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|