C19H26N4O6S — CID 44579016
2-[(2-aminophenyl)sulfonyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]amino]ethyl 2,2-dimethylpropanoate (PubChem CID 44579016) has the molecular formula C19H26N4O6S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-[(2-aminophenyl)sulfonyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]amino]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2-aminophenyl)sulfonyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]amino]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 44579016 |
| Molecular Formula | C19H26N4O6S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[(2-aminophenyl)sulfonyl-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]amino]ethyl 2,2-dimethylpropanoate |
| SMILES | Cc1cn(CN(CCOC(=O)C(C)(C)C)S(=O)(=O)c2ccccc2N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N4O6S/c1-13-11-22(18(26)21-16(13)24)12-23(9-10-29-17(25)19(2,3)4)30(27,28)15-8-6-5-7-14(15)20/h5-8,11H,9-10,12,20H2,1-4H3,(H,21,24,26) |
| InChIKey | LWBNMRKVXSWUDV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|