About 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide
9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide (PubChem CID 44579073) has the molecular formula C27H26N2O
and a molecular weight of 394.52 g/mol. Its IUPAC name is 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide.
Molecular Properties
| Compound Name | 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide |
| PubChem CID | 44579073 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide |
| SMILES | CCCCc1ccc(-c2ccc3c4c([nH]c3c2)-c2ccc(C(N)=O)cc2CC4)cc1 |
| InChI | InChI=1S/C27H26N2O/c1-2-3-4-17-5-7-18(8-6-17)19-9-13-23-24-14-10-20-15-21(27(28)30)11-12-22(20)26(24)29-25(23)16-19/h5-9,11-13,15-16,29H,2-4,10,14H2,1H3,(H2,28,30) |
| InChIKey | OBBPIWXGASAMQC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide?
The IUPAC name of 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide (CID 44579073) is 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide.
What is the SMILES notation for 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide?
The canonical SMILES for 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide is CCCCc1ccc(-c2ccc3c4c([nH]c3c2)-c2ccc(C(N)=O)cc2CC4)cc1.
What is the InChIKey of 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide?
The InChIKey is OBBPIWXGASAMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O/c1-2-3-4-17-5-7-18(8-6-17)19-9-13-23-24-14-10-20-15-21(27(28)30)11-12-22(20)26(24)29-25(23)16-19/h5-9,11-13,15-16,29H,2-4,10,14H2,1H3,(H2,28,30).
What are the key properties of 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide?
9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide has a molecular weight of 394.52 g/mol, XLogP of 6.04, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-butylphenyl)-6,11-dihydro-5H-benzo[a]carbazole-3-carboxamide is sourced from PubChem (CID 44579073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).