C24H34O3 — CID 44579126
(1S,4aS,10aR)-6-(cyclohexylmethoxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 44579126) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (1S,4aS,10aR)-6-(cyclohexylmethoxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1S,4aS,10aR)-6-(cyclohexylmethoxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 44579126 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (1S,4aS,10aR)-6-(cyclohexylmethoxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CCC[C@]2(C)c3cc(OCC4CCCCC4)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C24H34O3/c1-23-13-6-14-24(2,22(25)26)21(23)12-10-18-9-11-19(15-20(18)23)27-16-17-7-4-3-5-8-17/h9,11,15,17,21H,3-8,10,12-14,16H2,1-2H3,(H,25,26)/t21-,23-,24+/m1/s1 |
| InChIKey | KSWQIYCBBRHCCD-JRFVFWCSSA-N |
| XLogP | 5.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |