C20H18N6OS3 — CID 44579154
(5Z)-2-imino-3-(1,3-thiazol-2-yl)-5-[[5-(4-thiomorpholin-4-ylphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 44579154) has the molecular formula C20H18N6OS3 and a molecular weight of 454.61 g/mol. Its IUPAC name is (5Z)-2-imino-3-(1,3-thiazol-2-yl)-5-[[5-(4-thiomorpholin-4-ylphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-imino-3-(1,3-thiazol-2-yl)-5-[[5-(4-thiomorpholin-4-ylphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 44579154 |
| Molecular Formula | C20H18N6OS3 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (5Z)-2-imino-3-(1,3-thiazol-2-yl)-5-[[5-(4-thiomorpholin-4-ylphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2cn[nH]c2-c2ccc(N3CCSCC3)cc2)C(=O)N1c1nccs1 |
| InChI | InChI=1S/C20H18N6OS3/c21-19-26(20-22-5-8-29-20)18(27)16(30-19)11-14-12-23-24-17(14)13-1-3-15(4-2-13)25-6-9-28-10-7-25/h1-5,8,11-12,21H,6-7,9-10H2,(H,23,24)/b16-11-,21-19- |
| InChIKey | NSFSQSQADVOSJF-LCUCDLPVSA-N |
| XLogP | 4.14 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|