About (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene
(4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene (PubChem CID 44579277) has the molecular formula C18H18ClN3
and a molecular weight of 311.82 g/mol. Its IUPAC name is (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene |
| PubChem CID | 44579277 |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene |
| SMILES | CN1/C(=C\N=N\c2ccc(Cl)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C18H18ClN3/c1-18(2)15-6-4-5-7-16(15)22(3)17(18)12-20-21-14-10-8-13(19)9-11-14/h4-12H,1-3H3/b17-12-,21-20+ |
| InChIKey | ZFHDFPPEGDPOSF-WIQPNEMMSA-N |
| XLogP | 5.69 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene?
The IUPAC name of (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene (CID 44579277) is (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene.
What is the SMILES notation for (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene?
The canonical SMILES for (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene is CN1/C(=C\N=N\c2ccc(Cl)cc2)C(C)(C)c2ccccc21.
What is the InChIKey of (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene?
The InChIKey is ZFHDFPPEGDPOSF-WIQPNEMMSA-N. The full InChI is InChI=1S/C18H18ClN3/c1-18(2)15-6-4-5-7-16(15)22(3)17(18)12-20-21-14-10-8-13(19)9-11-14/h4-12H,1-3H3/b17-12-,21-20+.
What are the key properties of (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene?
(4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene has a molecular weight of 311.82 g/mol, XLogP of 5.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]diazene is sourced from PubChem (CID 44579277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).