About benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate
benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate (PubChem CID 44579619) has the molecular formula C28H22O6S2
and a molecular weight of 518.61 g/mol. Its IUPAC name is benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate.
Molecular Properties
| Compound Name | benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate |
| PubChem CID | 44579619 |
| Molecular Formula | C28H22O6S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate |
| SMILES | O=C(CSC1=C(SCC(=O)OCc2ccccc2)C(=O)c2ccccc2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H22O6S2/c29-23(33-15-19-9-3-1-4-10-19)17-35-27-25(31)21-13-7-8-14-22(21)26(32)28(27)36-18-24(30)34-16-20-11-5-2-6-12-20/h1-14H,15-18H2 |
| InChIKey | XFRKUIZHPLHNOL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate?
The IUPAC name of benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate (CID 44579619) is benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate.
What is the SMILES notation for benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate?
The canonical SMILES for benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate is O=C(CSC1=C(SCC(=O)OCc2ccccc2)C(=O)c2ccccc2C1=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate?
The InChIKey is XFRKUIZHPLHNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22O6S2/c29-23(33-15-19-9-3-1-4-10-19)17-35-27-25(31)21-13-7-8-14-22(21)26(32)28(27)36-18-24(30)34-16-20-11-5-2-6-12-20/h1-14H,15-18H2.
What are the key properties of benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate?
benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate has a molecular weight of 518.61 g/mol, XLogP of 5.23, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[1,4-dioxo-3-(2-oxo-2-phenylmethoxyethyl)sulfanylnaphthalen-2-yl]sulfanylacetate is sourced from PubChem (CID 44579619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).