About 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one
4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one (PubChem CID 44579827) has the molecular formula C25H21N3O2
and a molecular weight of 395.46 g/mol. Its IUPAC name is 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one |
| PubChem CID | 44579827 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one |
| SMILES | O=C1OC2(CCC(c3nc4ccc(-c5cccnc5)cc4[nH]3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H21N3O2/c29-24-19-5-1-2-6-20(19)25(30-24)11-9-16(10-12-25)23-27-21-8-7-17(14-22(21)28-23)18-4-3-13-26-15-18/h1-8,13-16H,9-12H2,(H,27,28) |
| InChIKey | DJRLKPRCVWGJAO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one?
The IUPAC name of 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one (CID 44579827) is 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one.
What is the SMILES notation for 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one?
The canonical SMILES for 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one is O=C1OC2(CCC(c3nc4ccc(-c5cccnc5)cc4[nH]3)CC2)c2ccccc21.
What is the InChIKey of 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one?
The InChIKey is DJRLKPRCVWGJAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O2/c29-24-19-5-1-2-6-20(19)25(30-24)11-9-16(10-12-25)23-27-21-8-7-17(14-22(21)28-23)18-4-3-13-26-15-18/h1-8,13-16H,9-12H2,(H,27,28).
What are the key properties of 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one?
4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one has a molecular weight of 395.46 g/mol, XLogP of 5.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-(6-pyridin-3-yl-1H-benzimidazol-2-yl)spiro[2-benzofuran-3,1'-cyclohexane]-1-one is sourced from PubChem (CID 44579827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).