About N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine
N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine (PubChem CID 44579871) has the molecular formula C27H29FN2
and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine |
| PubChem CID | 44579871 |
| Molecular Formula | C27H29FN2 |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine |
| SMILES | Cc1ccc(CN(C)CCCc2cn(-c3ccc(F)cc3)c3ccccc23)cc1C |
| InChI | InChI=1S/C27H29FN2/c1-20-10-11-22(17-21(20)2)18-29(3)16-6-7-23-19-30(25-14-12-24(28)13-15-25)27-9-5-4-8-26(23)27/h4-5,8-15,17,19H,6-7,16,18H2,1-3H3 |
| InChIKey | LAXUCYFTRUFSCD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine?
The IUPAC name of N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine (CID 44579871) is N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine.
What is the SMILES notation for N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine?
The canonical SMILES for N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine is Cc1ccc(CN(C)CCCc2cn(-c3ccc(F)cc3)c3ccccc23)cc1C.
What is the InChIKey of N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine?
The InChIKey is LAXUCYFTRUFSCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29FN2/c1-20-10-11-22(17-21(20)2)18-29(3)16-6-7-23-19-30(25-14-12-24(28)13-15-25)27-9-5-4-8-26(23)27/h4-5,8-15,17,19H,6-7,16,18H2,1-3H3.
What are the key properties of N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine?
N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine has a molecular weight of 400.54 g/mol, XLogP of 6.45, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethylphenyl)methyl]-3-[1-(4-fluorophenyl)indol-3-yl]-N-methylpropan-1-amine is sourced from PubChem (CID 44579871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).